
CAS 162358-03-4
:2-(4-Octanoylphenyl)ethyl acetate
Description:
2-(4-Octanoylphenyl)ethyl acetate is an organic compound characterized by its ester functional group, which is formed from the reaction of an alcohol and a carboxylic acid. This compound features a phenyl ring substituted with an octanoyl group, contributing to its hydrophobic characteristics and potentially influencing its solubility and volatility. The presence of the ethyl acetate moiety suggests that it may exhibit moderate polarity, making it soluble in various organic solvents. Its molecular structure indicates potential applications in the fields of fragrance, flavoring, or as an intermediate in organic synthesis. Additionally, the compound may possess specific physical properties such as a distinct boiling point and melting point, which are influenced by its molecular weight and structure. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance. Overall, 2-(4-Octanoylphenyl)ethyl acetate represents a unique compound with potential utility in various chemical applications.
Formula:C18H26O3
InChI:InChI=1S/C18H26O3/c1-3-4-5-6-7-8-18(20)17-11-9-16(10-12-17)13-14-21-15(2)19/h9-12H,3-8,13-14H2,1-2H3
SMILES:CCCCCCCC(=O)c1ccc(cc1)CCOC(=O)C
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

