CAS 16236-73-0
:N,N-Dicyclohexyl-1-piperidinemethanamine
Description:
N,N-Dicyclohexyl-1-piperidinemethanamine, with the CAS number 16236-73-0, is an organic compound characterized by its amine functional group and the presence of two cyclohexyl groups attached to a piperidine ring. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is known for its role as a ligand in coordination chemistry and as a potential building block in organic synthesis. The presence of the piperidine moiety contributes to its basicity, making it a useful intermediate in the synthesis of various pharmaceuticals and agrochemicals. Additionally, the steric bulk provided by the cyclohexyl groups can influence its reactivity and selectivity in chemical reactions. Safety data indicates that, like many amines, it may be irritating to the skin and eyes, and appropriate handling precautions should be taken. Overall, N,N-Dicyclohexyl-1-piperidinemethanamine is valued in both academic and industrial chemistry for its unique structural features and reactivity.
Formula:C18H34N2
InChI:InChI=1S/C18H34N2/c1-4-10-17(11-5-1)20(18-12-6-2-7-13-18)16-19-14-8-3-9-15-19/h17-18H,1-16H2
InChI key:InChIKey=JXNAZBPORFFGGF-UHFFFAOYSA-N
SMILES:N(CN1CCCCC1)(C2CCCCC2)C3CCCCC3
Synonyms:- 1-Piperidinemethanamine, N,N-dicyclohexyl-
- Piperidine, 1-[(dicyclohexylamino)methyl]-
- N,N-Dicyclohexyl-1-piperidinemethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
