
CAS 1624260-69-0
:1,3a,5,6-Tetrahydro-6-[1-(phenylmethyl)-2-piperidinyl]-1-(tetrahydro-2H-pyran-4-yl)-4H-pyrazolo[3,4-d]pyrimidin-4-one
Description:
1,3a,5,6-Tetrahydro-6-[1-(phenylmethyl)-2-piperidinyl]-1-(tetrahydro-2H-pyran-4-yl)-4H-pyrazolo[3,4-d]pyrimidin-4-one is a complex organic compound characterized by its multi-cyclic structure, which includes a pyrazolo-pyrimidine core. This compound features several functional groups, including a piperidine ring and a tetrahydro-pyran moiety, contributing to its potential biological activity. The presence of the phenylmethyl group suggests possible interactions with biological targets, making it of interest in medicinal chemistry. Its molecular structure indicates that it may exhibit properties such as lipophilicity and the ability to cross biological membranes, which are important for pharmacological applications. The compound's synthesis and characterization would typically involve techniques such as NMR spectroscopy, mass spectrometry, and possibly X-ray crystallography to confirm its structure. Given its complexity, it may also exhibit specific stereochemistry, influencing its biological interactions and efficacy. Overall, this compound represents a class of molecules that could be explored for therapeutic applications, particularly in areas related to neuropharmacology or other medicinal fields.
Formula:C22H29N5O2
InChI:InChI=1S/C22H29N5O2/c28-22-18-14-23-27(17-9-12-29-13-10-17)21(18)24-20(25-22)19-8-4-5-11-26(19)15-16-6-2-1-3-7-16/h1-3,6-7,14,17-20H,4-5,8-13,15H2,(H,25,28)
InChI key:InChIKey=PQYURWIRBUDGPO-UHFFFAOYSA-N
SMILES:O=C1C2C(N(N=C2)C3CCOCC3)=NC(N1)C4N(CC5=CC=CC=C5)CCCC4
Synonyms:- 4H-Pyrazolo[3,4-d]pyrimidin-4-one, 1,3a,5,6-tetrahydro-6-[1-(phenylmethyl)-2-piperidinyl]-1-(tetrahydro-2H-pyran-4-yl)-
- 1,3a,5,6-Tetrahydro-6-[1-(phenylmethyl)-2-piperidinyl]-1-(tetrahydro-2H-pyran-4-yl)-4H-pyrazolo[3,4-d]pyrimidin-4-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
6-(1-Benzylpiperidin-2-yl)-1-(tetrahydro-2H-pyran-4-yl)-5,6-dihydro-1H-pyrazolo[3,4-d]pyrimidin-4(3aH)-one
CAS:Formula:C22H29N5O2Molecular weight:395.4980
