CymitQuimica logo

CAS 1624260-75-8

:

3-Piperidinamine, N-methyl-, hydrochloride (1:1), (3S)-

Description:
3-Piperidinamine, N-methyl-, hydrochloride (1:1), (3S)- is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The "N-methyl" designation indicates that a methyl group is attached to the nitrogen atom of the piperidine, enhancing its basicity and solubility in polar solvents. The hydrochloride salt form suggests that the compound is protonated, which typically increases its stability and solubility in aqueous environments. The (3S) notation indicates the specific stereochemistry of the compound, which is crucial for its biological activity and interaction with receptors. This compound may exhibit properties relevant to medicinal chemistry, potentially acting as a pharmacological agent due to its structural features. Its applications could span various fields, including drug development and synthesis, although specific biological activities would depend on further empirical studies. As with many amines, it is likely to be hygroscopic and should be handled with care to avoid moisture absorption.
Formula:C6H14N2·ClH
InChI:InChI=1S/C6H14N2.ClH/c1-7-6-3-2-4-8-5-6;/h6-8H,2-5H2,1H3;1H/t6-;/m0./s1
InChI key:InChIKey=BVJYJSOAGMETHE-RGMNGODLSA-N
SMILES:N(C)[C@H]1CCCNC1.Cl
Synonyms:
  • 3-Piperidinamine, N-methyl-, hydrochloride (1:1), (3S)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.