CymitQuimica logo

CAS 1624262-44-7

:

3-(5-Bromo-2-chloro-4-pyrimidinyl)-1-(phenylsulfonyl)-1H-indole

Description:
3-(5-Bromo-2-chloro-4-pyrimidinyl)-1-(phenylsulfonyl)-1H-indole is a chemical compound characterized by its complex structure, which includes an indole core, a pyrimidine ring, and a phenylsulfonyl group. The presence of bromine and chlorine substituents on the pyrimidine ring contributes to its reactivity and potential biological activity. This compound is likely to exhibit properties such as moderate solubility in organic solvents and potential interactions with biological targets, making it of interest in medicinal chemistry. The indole moiety is known for its role in various pharmacological activities, while the sulfonyl group can enhance the compound's ability to form hydrogen bonds and interact with proteins. Its specific applications may include use as a pharmaceutical intermediate or in the development of targeted therapies, particularly in oncology or infectious disease research. As with many synthetic compounds, safety and handling precautions are essential due to potential toxicity or reactivity.
Formula:C18H11BrClN3O2S
InChI:InChI=1S/C18H11BrClN3O2S/c19-15-10-21-18(20)22-17(15)14-11-23(16-9-5-4-8-13(14)16)26(24,25)12-6-2-1-3-7-12/h1-11H
InChI key:InChIKey=ATOBJZOVMPIWCJ-UHFFFAOYSA-N
SMILES:BrC=1C(C=2C=3C(N(S(=O)(=O)C4=CC=CC=C4)C2)=CC=CC3)=NC(Cl)=NC1
Synonyms:
  • 1-(Benzenesulfonyl)-3-(5-bromo-2-chloropyrimidin-4-yl)indole
  • 1H-Indole, 3-(5-bromo-2-chloro-4-pyrimidinyl)-1-(phenylsulfonyl)-
  • 3-(5-Bromo-2-chloro-4-pyrimidinyl)-1-(phenylsulfonyl)-1H-indole
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.