CAS 1624262-49-2
:2,5-Dichloro-1-methyl-4-piperidinone
Description:
2,5-Dichloro-1-methyl-4-piperidinone is a chemical compound characterized by its piperidinone structure, which includes a six-membered ring containing nitrogen. The presence of two chlorine atoms at the 2 and 5 positions of the ring contributes to its reactivity and potential applications in various chemical syntheses. The methyl group at the 1 position enhances its lipophilicity, which can influence its solubility and interaction with biological systems. This compound is typically used in the synthesis of pharmaceuticals and agrochemicals, owing to its ability to serve as an intermediate in the production of more complex molecules. Its physical properties, such as boiling point, melting point, and solubility, can vary based on the specific conditions and purity of the substance. Safety data indicates that, like many chlorinated compounds, it may pose environmental and health risks, necessitating careful handling and disposal. Overall, 2,5-Dichloro-1-methyl-4-piperidinone is a versatile compound with significant relevance in organic chemistry and medicinal applications.
Formula:C6H9Cl2NO
InChI:InChI=1S/C6H9Cl2NO/c1-9-3-4(7)5(10)2-6(9)8/h4,6H,2-3H2,1H3
InChI key:InChIKey=RKBQLVUHMNKYEG-UHFFFAOYSA-N
SMILES:ClC1C(=O)CC(Cl)N(C)C1
Synonyms:- 4-Piperidinone, 2,5-dichloro-1-methyl-
- 2,5-Dichloro-1-methyl-4-piperidinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
