CAS 16252-53-2

3,4-Dihydro-2-(hydroxymethylene)-6-methoxy-1(2H)-naphthalenone

Description:

3,4-Dihydro-2-(hydroxymethylene)-6-methoxy-1(2H)-naphthalenone, with CAS number 16252-53-2, is a chemical compound that belongs to the class of naphthalenones, which are characterized by a naphthalene ring structure with various functional groups. This particular compound features a hydroxymethylene group and a methoxy group, contributing to its potential reactivity and biological activity. It is typically a solid at room temperature and may exhibit solubility in organic solvents, depending on the specific conditions. The presence of the hydroxymethylene group suggests potential for hydrogen bonding, which can influence its interactions in biological systems. Additionally, the methoxy group can affect the compound's electronic properties and stability. This compound may be of interest in medicinal chemistry due to its structural features, which could be linked to various pharmacological activities. However, detailed studies would be necessary to fully elucidate its properties, reactivity, and potential applications in research or industry.

Formula: C₁₂H₁₂O₃

InChI: InChI=1S/C12H12O3/c1-15-10-4-5-11-8(6-10)2-3-9(7-13)12(11)14/h4-7,13H,2-3H2,1H3

InChI key: InChIKey=DLZNDSMSFGMMHU-UHFFFAOYSA-N

SMILES: O=C1C=2C(=CC(OC)=CC2)CCC1=CO

Synonyms:

• 3,4-Dihydro-2-(hydroxymethylene)-6-methoxy-1(2H)-naphthalenone
• 1(2H)-Naphthalenone, 3,4-dihydro-2-(hydroxymethylene)-6-methoxy-
• 2-(Hydroxymethylene)-6-methoxy-3,4-dihydronaphthalen-1(2H)-one
• NSC 99370
• 2-Hydroxymethylene-6-methoxy-1-tetralone

1(2H)-Naphthalenone, 3,4-dihydro-2-(hydroxymethylene)-6-methoxy-

CAS: 16252-53-2

Formula: C₁₂H₁₂O₃

Molecular weight: 204.2219

Ref: IN-DA001T8G