CymitQuimica logo

CAS 162537-10-2

:

methyl (2S)-3-methyl-2-[(4-nitrophenoxy)carbonylamino]butanoate

Description:
Methyl (2S)-3-methyl-2-[(4-nitrophenoxy)carbonylamino]butanoate, with the CAS number 162537-10-2, is an organic compound characterized by its ester functional group, which is typical of methyl esters. This compound features a chiral center, indicated by the (2S) designation, suggesting it exists in a specific stereoisomeric form. The presence of a 4-nitrophenoxy group indicates that it has a nitro substituent on a phenyl ring, which can influence its reactivity and polarity. The carbonylamino group suggests that it may participate in various chemical reactions, such as nucleophilic substitutions or hydrolysis. The overall structure implies potential applications in medicinal chemistry or as an intermediate in organic synthesis, particularly due to the presence of both the ester and amide functionalities. Additionally, the compound's solubility and stability can be influenced by the substituents on the aromatic ring and the overall molecular structure, making it a subject of interest in various chemical research fields.
Formula:C13H16N2O6
InChI:InChI=1/C13H16N2O6/c1-8(2)11(12(16)20-3)14-13(17)21-10-6-4-9(5-7-10)15(18)19/h4-8,11H,1-3H3,(H,14,17)/t11-/m0/s1
SMILES:CC(C)[C@@H](C(=O)OC)N=C(O)Oc1ccc(cc1)N(=O)=O
Synonyms:
  • L-Valine, N-[(4-nitrophenoxy)carbonyl]-, methyl ester
  • N-(4-Nitrophenoxycarbonyl)-L-valine Methyl Ester
  • Methyl (2S)-3-Methyl-2-[[(4-nitrophenoxy)carbonyl]aMino]butanoate
  • 162537-10-2
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.