CymitQuimica logo

CAS 162549-35-1

:

3-(3,5-DIFLUOROPHENYL)PENTANEDIOIC ACID

Description:
3-(3,5-Difluorophenyl)pentanedioic acid is an organic compound characterized by its structure, which includes a pentanedioic acid backbone substituted with a 3,5-difluorophenyl group. This compound features two carboxylic acid functional groups (-COOH) at the terminal positions of a five-carbon chain, contributing to its acidity and potential reactivity. The presence of the difluorophenyl substituent introduces unique electronic and steric properties, which can influence its behavior in chemical reactions and interactions with biological systems. This compound may exhibit solubility in polar solvents due to the carboxylic acid groups, while the fluorine atoms can enhance lipophilicity and alter the compound's overall polarity. Its potential applications could span various fields, including pharmaceuticals and agrochemicals, where such structural characteristics may impart specific biological activities or enhance the efficacy of active ingredients. As with many organic acids, it may participate in acid-base reactions, and its derivatives could be synthesized for further study or application.
Formula:C11H10F2O4
InChI:InChI=1/C11H10F2O4/c12-8-1-6(2-9(13)5-8)7(3-10(14)15)4-11(16)17/h1-2,5,7H,3-4H2,(H,14,15)(H,16,17)
SMILES:c1c(cc(cc1F)F)C(CC(=O)O)CC(=O)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.