CAS 16257-05-9
:N-T-boc-ile-gly
Description:
N-Tert-butoxycarbonyl (Boc)-L-isoleucine, commonly referred to as N-T-boc-ile-gly, is a protected form of the amino acid isoleucine. This compound is characterized by the presence of a tert-butoxycarbonyl (Boc) group, which serves as a protective group for the amino functionality, facilitating its use in peptide synthesis and other organic reactions. The Boc group is known for its stability under basic conditions and can be easily removed under acidic conditions, making it a valuable tool in synthetic chemistry. N-T-boc-ile-gly is typically a white to off-white solid and is soluble in organic solvents such as dichloromethane and dimethyl sulfoxide, but less soluble in water. Its molecular structure includes a branched aliphatic side chain, characteristic of isoleucine, contributing to its hydrophobic properties. This compound is utilized in the synthesis of peptides and other bioactive molecules, playing a crucial role in medicinal chemistry and biochemistry. Proper handling and storage are essential due to its chemical reactivity and potential hazards associated with its use.
Formula:C13H24N2O5
InChI:InChI=1S/C13H24N2O5/c1-6-8(2)10(11(18)14-7-9(16)17)15-12(19)20-13(3,4)5/h8,10H,6-7H2,1-5H3,(H,14,18)(H,15,19)(H,16,17)/t8-,10-/m0/s1
InChI key:OWJXXJTWCMKBCI-WPRPVWTQSA-N
SMILES:CC[C@H](C)[C@@H](C(=O)NCC(=O)O)NC(=O)OC(C)(C)C
Synonyms:- Boc-Ile-Gly-OH
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
2-((2S,3S)-2-((tert-Butoxycarbonyl)amino)-3-methylpentanamido)acetic acid
CAS:2-((2S,3S)-2-((tert-Butoxycarbonyl)amino)-3-methylpentanamido)acetic acidFormula:C13H24N2O5Purity:95%Molecular weight:288.342-((2S,3S)-2-((tert-Butoxycarbonyl)amino)-3-methylpentanamido)acetic acid
CAS:Formula:C13H24N2O5Purity:97%Molecular weight:288.3401Boc-Ile-Gly-OH
CAS:2-((2S,3S)-2-((tert-Butoxycarbonyl)amino)-3-methylpentanamido)acetic acidFormula:C13H24N2O5Purity:95%Molecular weight:288.342-((2S,3S)-2-((tert-Butoxycarbonyl)amino)-3-methylpentanamido)acetic acid
CAS:Molecular weight:288.3439941Boc-Ile-Gly-OH
CAS:Boc-Ile-Gly-OH is a reactive compound that contains an aldehyde group. It is catalytic and can be used in the synthesis of peptides, amino acids, and other compounds. Boc-Ile-Gly-OH is unmodified by reaction with carbonyl groups or any other functional groups. It has been modified by thermal treatment to produce an oxygen species at temperatures below 100°C.Formula:C13H24N2O5Purity:Min. 95%Molecular weight:288.34 g/mol




