CAS 162607-23-0
:B-(2,5-Dimethyl-3-thienyl)boronic acid
Description:
B-(2,5-Dimethyl-3-thienyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a thienyl ring. The thienyl moiety, derived from thiophene, contributes to its aromatic properties and potential reactivity. This compound typically exhibits good solubility in organic solvents, making it useful in various synthetic applications. Boronic acids are known for their ability to form reversible complexes with diols, which is a key feature in applications such as Suzuki-Miyaura cross-coupling reactions in organic synthesis. The presence of the dimethyl substituents on the thienyl ring can influence the electronic properties and steric hindrance, affecting its reactivity and interaction with other molecules. Additionally, B-(2,5-Dimethyl-3-thienyl)boronic acid may exhibit interesting photophysical properties, making it a candidate for use in materials science and organic electronics. Overall, its unique structure and functional properties make it a valuable compound in both academic research and industrial applications.
Formula:C6H9BO2S
InChI:InChI=1S/C6H9BO2S/c1-4-3-6(7(8)9)5(2)10-4/h3,8-9H,1-2H3
InChI key:InChIKey=RFQHMNWNEOZRLK-UHFFFAOYSA-N
SMILES:B(O)(O)C=1C=C(C)SC1C
Synonyms:- (2,5-Dimethyl-3-thienyl)boronic acid
- (2,5-Dimethylthiophen-3-yl)boronic acid
- 2,5-Dimethyl-3-thienylboronic acid
- 2,5-Dimethylthien-3-ylboronic acid
- B-(2,5-Dimethyl-3-thienyl)boronic acid
- Boronic acid, (2,5-dimethyl-3-thienyl)-
- boronic acid, B-(2,5-dimethyl-3-thienyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2,5-Dimethylthiophene-3-boronic acid, 95%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C6H9BO2SPurity:95%Color and Shape:Powder, WhiteMolecular weight:156.01Boronic acid, (2,5-dimethyl-3-thienyl)-
CAS:Formula:C6H9BO2SPurity:95%Color and Shape:SolidMolecular weight:156.01052,5-Dimethylthiophene-3-boronic acid
CAS:2,5-Dimethylthiophene-3-boronic acidFormula:C6H9BO2SPurity:95%Molecular weight:156.01046(2,5-Dimethylthiophen-3-yl)boronic acid
CAS:(2,5-Dimethylthiophen-3-yl)boronic acidFormula:C6H9BO2SPurity:95%Molecular weight:156.012,5-DIMETHYLTHIOPHENE-3-BORONIC ACID
CAS:Formula:C6H9BO2SPurity:98%Color and Shape:SolidMolecular weight:156.012,5-Dimethylthiophene-3-boronic Acid
CAS:Controlled ProductApplications 2,5-Dimethylthiophene-3-boronic acid
Formula:C6H9BO2SColor and Shape:NeatMolecular weight:156.01





