CymitQuimica logo

CAS 162607-27-4

:

B-(5-Ethyl-2-furanyl)boronic acid

Description:
B-(5-Ethyl-2-furanyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a furan ring that has an ethyl substituent at the 5-position. This compound typically exhibits properties common to boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The furan ring contributes to its aromatic character and can influence its reactivity and solubility. B-(5-Ethyl-2-furanyl)boronic acid is often utilized in cross-coupling reactions, particularly in the Suzuki-Miyaura reaction, which is a key method for forming carbon-carbon bonds. Its unique structure allows for potential applications in the development of pharmaceuticals and agrochemicals. Additionally, the compound's stability and reactivity can be affected by factors such as pH and the presence of other functional groups, making it a versatile building block in synthetic organic chemistry.
Formula:C6H9BO3
InChI:InChI=1S/C6H9BO3/c1-2-5-3-4-6(10-5)7(8)9/h3-4,8-9H,2H2,1H3
InChI key:InChIKey=JPZUKVZFTJPMTM-UHFFFAOYSA-N
SMILES:B(O)(O)C=1OC(CC)=CC1
Synonyms:
  • Boronic acid, B-(5-ethyl-2-furanyl)-
  • B-(5-Ethyl-2-furanyl)boronic acid
  • Boronic acid, (5-ethyl-2-furanyl)-
  • 5-Ethylfuran-2-boronic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.