CymitQuimica logo

CAS 162648-31-9

:

1-Benzoyl-4-methyl-4-piperidinecarboxylic acid

Description:
1-Benzoyl-4-methyl-4-piperidinecarboxylic acid is a chemical compound characterized by its piperidine ring structure, which is a six-membered ring containing one nitrogen atom. This compound features a benzoyl group and a methyl group attached to the piperidine, contributing to its unique properties. It is typically a white to off-white solid and is soluble in organic solvents, reflecting its moderate polarity. The presence of the carboxylic acid functional group indicates that it can participate in acid-base reactions and may exhibit acidic properties. This compound is of interest in medicinal chemistry and may have applications in drug development due to its structural features that can influence biological activity. Its CAS number, 162648-31-9, is a unique identifier that facilitates the search for information regarding its synthesis, properties, and potential uses in various chemical and pharmaceutical contexts. As with many organic compounds, safety data should be consulted to ensure proper handling and usage.
Formula:C14H17NO3
InChI:InChI=1S/C14H17NO3/c1-14(13(17)18)7-9-15(10-8-14)12(16)11-5-3-2-4-6-11/h2-6H,7-10H2,1H3,(H,17,18)
InChI key:InChIKey=JKGLTCBDQLNFEM-UHFFFAOYSA-N
SMILES:C(=O)(N1CCC(C(O)=O)(C)CC1)C2=CC=CC=C2
Synonyms:
  • 1-Benzoyl-4-methyl-4-piperidinecarboxylic acid
  • N-Benzoyl-4-methylisonipecotic acid
  • 4-Piperidinecarboxylic acid, 1-benzoyl-4-methyl-
Found 3 products.