
CAS 16268-98-7
:N2,N4,N6-Tris(1,1-dimethylethyl)-1,3,5-triazine-2,4,6-triamine
Description:
N2,N4,N6-Tris(1,1-dimethylethyl)-1,3,5-triazine-2,4,6-triamine, commonly known as a derivative of melamine, is a chemical compound characterized by its triazine ring structure, which is substituted with three bulky tert-butyl groups. This substitution enhances its thermal stability and hydrophobic properties, making it useful in various applications, including as a flame retardant and in the formulation of plastics and resins. The presence of multiple amine groups contributes to its reactivity, allowing it to participate in condensation reactions and form cross-linked networks. The compound is typically solid at room temperature and exhibits low solubility in water due to its hydrophobic nature. Its chemical stability and resistance to degradation under heat make it suitable for high-performance materials. However, safety considerations must be taken into account, as with many nitrogen-rich compounds, due to potential toxicity and environmental impact. Overall, this compound is significant in materials science and industrial applications, particularly in enhancing the properties of polymers.
Formula:C15H30N6
InChI:InChI=1S/C15H30N6/c1-13(2,3)19-10-16-11(20-14(4,5)6)18-12(17-10)21-15(7,8)9/h1-9H3,(H3,16,17,18,19,20,21)
InChI key:InChIKey=XYKRYUFUYDCUFM-UHFFFAOYSA-N
SMILES:N(C(C)(C)C)C=1N=C(NC(C)(C)C)N=C(NC(C)(C)C)N1
Synonyms:- 2,4,6-Tris(tert-butylamino)-s-triazine
- 1,3,5-Triazine-2,4,6-triamine, N,N′,N′′-tris(1,1-dimethylethyl)-
- N2,N4,N6-Tris(1,1-dimethylethyl)-1,3,5-triazine-2,4,6-triamine
- 1,3,5-Triazine-2,4,6-triamine, N2,N4,N6-tris(1,1-dimethylethyl)-
- Melamine, N2,N4,N6-tri-tert-butyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
