CAS 16269-01-5

1-[[4,6-Bis(dimethylamino)-1,3,5-triazin-2-yl]methylamino]methanol

Description:

1-[[4,6-Bis(dimethylamino)-1,3,5-triazin-2-yl]methylamino]methanol, with CAS number 16269-01-5, is a chemical compound characterized by its complex structure that includes a triazine ring and multiple amino groups. This substance typically exhibits properties associated with its nitrogen-rich framework, such as potential solubility in polar solvents and the ability to form hydrogen bonds due to the presence of hydroxyl (-OH) and amino (-NH) groups. It may act as a ligand in coordination chemistry or as a reagent in organic synthesis, particularly in reactions involving nucleophiles. The presence of dimethylamino groups suggests that it could exhibit basic properties, making it reactive in various chemical environments. Additionally, its triazine moiety may impart stability and influence its reactivity, particularly in biological systems or agricultural applications. Safety data should be consulted for handling and potential toxicity, as compounds with similar structures can exhibit varied biological activities.

Formula: C₉H₁₈N₆O

InChI: InChI=1S/C9H18N6O/c1-13(2)7-10-8(14(3)4)12-9(11-7)15(5)6-16/h16H,6H2,1-5H3

InChI key: InChIKey=GELQGNSEMRPIQJ-UHFFFAOYSA-N

SMILES: N(CO)(C)C=1N=C(N(C)C)N=C(N(C)C)N1

Synonyms:

• 1-[[4,6-Bis(dimethylamino)-1,3,5-triazin-2-yl]methylamino]methanol
• Methanol, [[4,6-bis(dimethylamino)-s-triazin-2-yl]methylamino]-
• Methanol, [[4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]methylamino]-
• Methanol, 1-[[4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]methylamino]-
• N-(Hydroxymethyl)pentamethylmelamine

Methanol, 1-[[4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]methylamino]-

CAS: 16269-01-5

Formula: C₉H₁₈N₆O

Molecular weight: 226.2788

Ref: IN-DA001TBK