CymitQuimica logo

CAS 1627-95-8

:

2-(Triethoxysilyl)butanenitrile

Description:
2-(Triethoxysilyl)butanenitrile, with the CAS number 1627-95-8, is an organosilicon compound characterized by the presence of a triethoxysilyl group attached to a butanenitrile moiety. This compound typically exhibits a silane structure, which allows it to function as a coupling agent or surface modifier, enhancing adhesion between organic materials and inorganic substrates. The triethoxysilyl group provides reactivity through hydrolysis and condensation, enabling the formation of siloxane bonds with surfaces such as glass, metals, and ceramics. The butanenitrile part contributes to the compound's polarity and potential reactivity, making it useful in various applications, including coatings, sealants, and as a precursor in the synthesis of hybrid organic-inorganic materials. Additionally, the presence of the nitrile functional group may impart specific chemical properties, such as increased solubility in polar solvents and potential interactions with other chemical species. Overall, 2-(Triethoxysilyl)butanenitrile is valued for its versatility in enhancing material properties and facilitating chemical bonding in composite systems.
Formula:C10H21NO3Si
InChI:InChI=1S/C10H21NO3Si/c1-5-10(9-11)15(12-6-2,13-7-3)14-8-4/h10H,5-8H2,1-4H3
InChI key:InChIKey=RDNFTJRPCZDKHN-UHFFFAOYSA-N
SMILES:[Si](C(CC)C#N)(OCC)(OCC)OCC
Synonyms:
  • Butanenitrile, 2-(triethoxysilyl)-
  • 2-(Triethoxysilyl)butanenitrile
  • Butyronitrile, 2-(triethoxysilyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.