
CAS 16276-38-3
:(4Z)-4-Methyl-4-octene
Description:
(4Z)-4-Methyl-4-octene is an organic compound classified as an alkene, characterized by the presence of a carbon-carbon double bond. Its structure features a branched chain with a methyl group attached to the fourth carbon of an octene backbone, which contributes to its unique properties. This compound is typically a colorless liquid at room temperature and exhibits a relatively low boiling point, indicative of its hydrocarbon nature. The presence of the double bond makes it more reactive than saturated hydrocarbons, allowing it to participate in various chemical reactions such as polymerization and hydrogenation. (4Z)-4-Methyl-4-octene is also notable for its potential applications in the synthesis of specialty chemicals and as an intermediate in organic synthesis. Additionally, its geometric isomerism, specifically the "Z" configuration, indicates that the highest priority substituents on the double bond are on the same side, which can influence its reactivity and physical properties. Overall, this compound is of interest in both industrial and research contexts due to its structural characteristics and reactivity.
Formula:C9H18
InChI:InChI=1S/C9H18/c1-4-6-8-9(3)7-5-2/h8H,4-7H2,1-3H3/b9-8-
InChI key:InChIKey=AACKTBLMYQELLG-HJWRWDBZSA-N
SMILES:C(=C\CCC)(\CCC)/C
Synonyms:- cis-4-Methyl-4-octene
- (Z)-4-Methyloct-4-ene
- (4Z)-4-Methyl-4-octene
- 4-Octene, 4-methyl-, (4Z)-
- 4-Octene, 4-methyl-, (Z)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
