CAS 1628557-02-7

1-Piperidinecarboxylic acid, 4-amino-3-fluoro-, 1,1-dimethylethyl ester, ethanedioate (1:1)

Description:

1-Piperidinecarboxylic acid, 4-amino-3-fluoro-, 1,1-dimethylethyl ester, ethanedioate (1:1), with CAS number 1628557-02-7, is a chemical compound characterized by its complex structure, which includes a piperidine ring, a carboxylic acid functional group, and an ester linkage. The presence of an amino group and a fluorine atom contributes to its unique reactivity and potential biological activity. This compound is likely to exhibit polar characteristics due to the carboxylic acid and amino functionalities, which can engage in hydrogen bonding. The dimethyl group attached to the ester may enhance its lipophilicity, influencing its solubility in organic solvents. Additionally, the ethanedioate component suggests the formation of a salt or a complex, which may affect its stability and reactivity. Overall, this compound may have applications in medicinal chemistry or as an intermediate in organic synthesis, although specific applications would depend on further research into its biological properties and reactivity.

Formula: C₁₀H₁₉FN₂O₂·C₂H₂O₄

InChI: InChI=1S/C10H19FN2O2.C2H2O4/c1-10(2,3)15-9(14)13-5-4-8(12)7(11)6-13;3-1(4)2(5)6/h7-8H,4-6,12H2,1-3H3;(H,3,4)(H,5,6)

InChI key: InChIKey=CXQVFHJSPORZAA-UHFFFAOYSA-N

SMILES: C(OC(C)(C)C)(=O)N1CC(F)C(N)CC1.C(C(O)=O)(O)=O

Synonyms:

• 1-Piperidinecarboxylic acid, 4-amino-3-fluoro-, 1,1-dimethylethyl ester, ethanedioate (1:1)

tert-Butyl 4-amino-3-fluoropiperidine-1-carboxylate oxalate

CAS: 1628557-02-7

Formula: C₁₂H₂₁FN₂O₆

Molecular weight: 308.3033

Ref: IN-DA001THV