
CAS 1628836-07-6
:1,1-Dimethylethyl N-(1-cyano-4-pentyn-1-yl)carbamate
Description:
1,1-Dimethylethyl N-(1-cyano-4-pentyn-1-yl)carbamate, identified by its CAS number 1628836-07-6, is a chemical compound that belongs to the class of carbamates. This substance features a carbamate functional group, which is characterized by the presence of a carbonyl group (C=O) bonded to a nitrogen atom (N) that is also connected to an alkyl or aryl group. The compound includes a dimethyl group, indicating the presence of two methyl groups attached to a tertiary carbon, which contributes to its steric bulk and potentially influences its reactivity and solubility. The cyano group (–C≡N) and the pentynyl chain suggest that the compound may exhibit unique chemical properties, including potential reactivity in nucleophilic addition reactions. Additionally, the presence of the cyano group may impart specific biological activities or applications in agrochemicals or pharmaceuticals. Overall, the structural features of this compound suggest it may have interesting applications in various chemical contexts, although specific properties such as solubility, melting point, and stability would require empirical data for precise characterization.
Formula:C11H16N2O2
InChI:InChI=1S/C11H16N2O2/c1-5-6-7-9(8-12)13-10(14)15-11(2,3)4/h1,9H,6-7H2,2-4H3,(H,13,14)
InChI key:InChIKey=XCFPILPFQVRYCZ-UHFFFAOYSA-N
SMILES:N(C(CCC#C)C#N)C(OC(C)(C)C)=O
Synonyms:- 1,1-Dimethylethyl N-(1-cyano-4-pentyn-1-yl)carbamate
- tert-Butyl (1-cyanopent-4-yn-1-yl)carbamate
- Carbamic acid, N-(1-cyano-4-pentyn-1-yl)-, 1,1-dimethylethyl ester
- ert-butyl(1-cyanopent-4-yn-1-yl)carbamate
- tert-butyl(1-cyanopent-4-yn-1-yl)carbamat
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
