![5-FLUORO-2-PHENYLBENZO[D]THIAZOLE](/_next/image/?url=https%3A%2Fstatic.cymitquimica.com%2Fcas-image%2Fthumb-webp%2F270002-5-fluoro-2-phenylbenzo-d-thiazole.webp&w=3840&q=75)
CAS 1629-93-2
:5-FLUORO-2-PHENYLBENZO[D]THIAZOLE
Description:
5-Fluoro-2-phenylbenzo[d]thiazole is a heterocyclic compound characterized by the presence of a thiazole ring fused to a phenyl group and substituted with a fluorine atom. This compound typically exhibits a pale yellow to light brown crystalline appearance. It is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its biological activity. The presence of the fluorine atom can enhance lipophilicity and metabolic stability, making it a valuable modification in drug design. The thiazole moiety contributes to its reactivity and interaction with biological targets. Additionally, 5-fluoro-2-phenylbenzo[d]thiazole may exhibit fluorescence properties, which can be useful in various analytical applications. Its solubility characteristics can vary depending on the solvent, influencing its behavior in biological systems and chemical reactions. Overall, this compound is of interest in both synthetic and medicinal chemistry for its unique structural features and potential therapeutic applications.
Formula:C13H8FNS
InChI:InChI=1/C13H8FNS/c14-10-6-7-12-11(8-10)15-13(16-12)9-4-2-1-3-5-9/h1-8H
SMILES:c1ccc(cc1)c1nc2cc(ccc2s1)F
Synonyms:- 5-Fluoro-2-Phenyl-1,3-Benzothiazole
- 5-FLUORO-2-PHENYLBENZO[D]THIAZOLE
- Benzothiazole, 5-fluoro-2-phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
