CAS 162965-54-0
:2-[(2,2,2-TRIFLUOROETHYL)THIO]-PYRIDINE
Description:
2-[(2,2,2-Trifluoroethyl)thio]-pyridine is a chemical compound characterized by the presence of a pyridine ring substituted with a thioether group, specifically a trifluoroethyl group. The trifluoroethyl moiety contributes to the compound's unique properties, including increased lipophilicity and potential for strong intermolecular interactions due to the electronegative fluorine atoms. This compound is typically a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. It exhibits moderate to high stability under standard conditions but may react with strong oxidizing agents. The presence of the sulfur atom in the thioether linkage can impart distinct reactivity, particularly in nucleophilic substitution reactions. Additionally, the trifluoromethyl group can influence the compound's biological activity, making it of interest in medicinal chemistry and agrochemical applications. Safety data should be consulted, as compounds containing fluorinated groups can pose specific health and environmental risks. Overall, 2-[(2,2,2-trifluoroethyl)thio]-pyridine is a versatile compound with potential applications in various chemical and pharmaceutical fields.
Formula:C7H6F3NS
InChI:InChI=1/C7H6F3NS/c8-7(9,10)5-12-6-3-1-2-4-11-6/h1-4H,5H2
SMILES:c1ccnc(c1)SCC(F)(F)F
Synonyms:- 2-[(2,2,2-Trifluoroethyl)Sulfanyl]Pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
