CymitQuimica logo

CAS 163041-87-0

:

E3,Z8-tetradecadienly acetate

Description:
E3,Z8-tetradecadienyl acetate, with the CAS number 163041-87-0, is an organic compound characterized by its structure as an acetate ester derived from a long-chain fatty acid. This compound features a tetradecadienyl moiety, indicating the presence of a 14-carbon chain with two double bonds located at the 3rd and 8th positions, which contributes to its unsaturated nature. The presence of the acetate functional group suggests that it is formed from the reaction of a tetradecadienol with acetic acid or acetic anhydride. E3,Z8-tetradecadienyl acetate is typically a colorless to pale yellow liquid with a characteristic odor, making it of interest in various applications, including fragrance and flavor industries. Its unsaturation may impart specific reactivity, influencing its behavior in chemical reactions, such as polymerization or oxidation. Additionally, the compound's physical properties, such as boiling point and solubility, are influenced by its molecular structure, making it relevant in both synthetic and natural product chemistry.
Formula:C16H28O2
InChI:InChI=1S/C16H28O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-18-16(2)17/h7-8,12-13H,3-6,9-11,14-15H2,1-2H3/b8-7+,13-12+
InChI key:WWXVCCMNRBSSKV-GEJAPMDVSA-N
SMILES:CCCCC/C=C/CCC/C=C/CCOC(=O)C
Synonyms:
  • 3,8-Tetradecadien-1-ol, acetate, (3E,8Z)-
Found 6 products.