CAS 1630906-84-1

5,7-Dichloro-2-cyclopropyl-2H-pyrazolo[4,3-d]pyrimidine

Description:

5,7-Dichloro-2-cyclopropyl-2H-pyrazolo[4,3-d]pyrimidine is a heterocyclic compound characterized by its unique bicyclic structure, which incorporates both pyrazole and pyrimidine rings. The presence of two chlorine atoms at the 5 and 7 positions contributes to its reactivity and potential biological activity. The cyclopropyl group at the 2 position introduces strain and can influence the compound's interaction with biological targets. This compound is often studied for its potential pharmacological properties, particularly in the context of medicinal chemistry, where modifications to the core structure can lead to enhanced efficacy or selectivity in drug development. Its molecular structure suggests potential applications in areas such as anti-inflammatory or anti-cancer therapies, although specific biological activities would depend on further empirical studies. Additionally, the compound's solubility, stability, and reactivity can be influenced by the presence of the halogen substituents and the cyclic structure, making it a subject of interest in both synthetic and medicinal chemistry research.

Formula: C₈H₆Cl₂N₄

InChI: InChI=1S/C8H6Cl2N4/c9-7-6-5(11-8(10)12-7)3-14(13-6)4-1-2-4/h3-4H,1-2H2

InChI key: InChIKey=DHOPBSQPTHVAKG-UHFFFAOYSA-N

SMILES: ClC=1C=2C(=CN(N2)C3CC3)N=C(Cl)N1

Synonyms:

• 5,7-Dichloro-2-cyclopropyl-2H-pyrazolo[4,3-d]pyrimidine
• 2H-Pyrazolo[4,3-d]pyrimidine, 5,7-dichloro-2-cyclopropyl-

5,7-dichloro-2-cyclopropyl-2H-pyrazolo[4,3-d]pyrimidine

CAS: 1630906-84-1

Formula: C₈H₆Cl₂N₄

Molecular weight: 229.0660

Ref: IN-DA001TR0