CymitQuimica logo

CAS 1630906-96-5

:

5,7-Dichloro-2-(2-methoxyethyl)-2H-pyrazolo[4,3-d]pyrimidine

Description:
5,7-Dichloro-2-(2-methoxyethyl)-2H-pyrazolo[4,3-d]pyrimidine is a heterocyclic compound characterized by its pyrazolo-pyrimidine structure, which incorporates both pyrazole and pyrimidine rings. This compound features two chlorine atoms at the 5 and 7 positions, contributing to its reactivity and potential biological activity. The presence of a methoxyethyl group at the 2 position enhances its solubility and may influence its pharmacokinetic properties. Typically, such compounds are of interest in medicinal chemistry due to their potential as therapeutic agents, particularly in the fields of oncology and neurology. The molecular structure suggests that it may interact with various biological targets, potentially acting as an inhibitor or modulator. Its unique combination of functional groups and halogen substituents may also impart specific electronic properties, making it suitable for further chemical modifications. As with many synthetic compounds, understanding its stability, solubility, and reactivity is crucial for applications in drug development and research.
Formula:C8H8Cl2N4O
InChI:InChI=1S/C8H8Cl2N4O/c1-15-3-2-14-4-5-6(13-14)7(9)12-8(10)11-5/h4H,2-3H2,1H3
InChI key:InChIKey=ZMUFOSSHRVESLG-UHFFFAOYSA-N
SMILES:ClC=1C=2C(=CN(CCOC)N2)N=C(Cl)N1
Synonyms:
  • 5,7-Dichloro-2-(2-methoxyethyl)-2H-pyrazolo[4,3-d]pyrimidine
  • 2H-Pyrazolo[4,3-d]pyrimidine, 5,7-dichloro-2-(2-methoxyethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.