CymitQuimica logo

CAS 1630907-13-9

:

2-Methyl-2-propanyl (3aR,6aS)-5-amino-3,3a,4,6a-tetrahydrocyclopenta[c]pyrrole-2(1H)-carboxylate hydrochloride (1:1)

Description:
2-Methyl-2-propanyl (3aR,6aS)-5-amino-3,3a,4,6a-tetrahydrocyclopenta[c]pyrrole-2(1H)-carboxylate hydrochloride (1:1) is a chemical compound characterized by its complex bicyclic structure, which includes a cyclopentane ring fused with a pyrrole moiety. The presence of an amino group and a carboxylate functional group suggests potential for biological activity, possibly as a pharmaceutical agent. The hydrochloride salt form indicates enhanced solubility in aqueous environments, which is often advantageous for drug formulation and delivery. The stereochemistry, denoted by the (3aR,6aS) configuration, implies specific spatial arrangements of atoms that can influence the compound's reactivity and interaction with biological targets. This compound may exhibit properties such as moderate to high polarity, depending on the substituents and functional groups present. Its potential applications could span various fields, including medicinal chemistry and biochemistry, particularly in the development of therapeutic agents. However, detailed studies would be necessary to fully elucidate its properties and biological effects.
Formula:C12H21ClN2O2
InChI:InChI=1S/C12H22N2O2.ClH/c1-12(2,3)16-11(15)14-6-8-4-10(13)5-9(8)7-14;/h8-10H,4-7,13H2,1-3H3;1H/t8-,9+,10?;
InChI key:QTIYWOFJLXOAGI-CVLICLBHSA-N
SMILES:CC(C)(C)OC(=O)N1C[C@H]2CC(C[C@H]2C1)N.Cl
Found 4 products.