CymitQuimica logo

CAS 1631747-25-5

:

(1R)‐2,2‐difluorocyclopropane‐1‐carboxylic acid

Description:
(1R)-2,2-Difluorocyclopropane-1-carboxylic acid is a fluorinated organic compound characterized by its cyclopropane structure, which features a carboxylic acid functional group and two fluorine atoms attached to the cyclopropane ring. The presence of the carboxylic acid group imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. The difluorination introduces unique electronic and steric effects, which can influence the compound's reactivity and stability. This compound may exhibit interesting properties in terms of solubility, boiling point, and reactivity due to the electronegative fluorine atoms, which can affect hydrogen bonding and molecular interactions. Its chirality, indicated by the (1R) designation, suggests that it exists as a specific enantiomer, which can have implications in biological activity and pharmacological applications. Overall, (1R)-2,2-difluorocyclopropane-1-carboxylic acid is of interest in synthetic chemistry and may have potential applications in pharmaceuticals and agrochemicals.
Formula:C4H4F2O2
InChI:InChI=1S/C4H4F2O2/c5-4(6)1-2(4)3(7)8/h2H,1H2,(H,7,8)/t2-/m1/s1
InChI key:KMLMOVWSQPHQME-UWTATZPHSA-N
SMILES:C1[C@@H](C1(F)F)C(=O)O
Synonyms:
  • (1R)‐2,2‐difluorocyclopropane‐1‐carboxylic acid
  • (R)-2,2-difluorocyclopropanecarboxylic acid
  • (R)-2,2-difluorocyclopropane-1-carboxylic acid
  • (1R)-2,2-difluorocyclopropanecarboxylic acid
  • Cyclopropanecarboxylic acid, 2,2-difluoro-, (1R)-
Found 5 products.