CAS 16318-87-9

4-[(4-Amino-3-methylphenyl)butylamino]-1-butanesulfonic acid

Description:

4-[(4-Amino-3-methylphenyl)butylamino]-1-butanesulfonic acid, commonly referred to as a sulfonic acid derivative, is characterized by its complex structure that includes an amino group, a butylamine chain, and a sulfonic acid functional group. This compound is typically a white to off-white solid and is soluble in water due to the presence of the sulfonic acid group, which enhances its hydrophilicity. It exhibits basic properties owing to the amino groups, allowing it to participate in various chemical reactions, including protonation and nucleophilic substitutions. The presence of the aromatic ring contributes to its stability and potential for interactions with other molecules, making it useful in biochemical applications. Additionally, its unique structure may impart specific biological activities, which can be explored in pharmaceutical and research contexts. Overall, this compound's characteristics make it a valuable substance in both synthetic and applied chemistry.

Formula: C₁₅H₂₆N₂O₃S

InChI: InChI=1S/C15H26N2O3S/c1-3-4-9-17(10-5-6-11-21(18,19)20)14-7-8-15(16)13(2)12-14/h7-8,12H,3-6,9-11,16H2,1-2H3,(H,18,19,20)

InChI key: InChIKey=QTAOWEXRKVVCES-UHFFFAOYSA-N

SMILES: N(CCCCS(=O)(=O)O)(CCCC)C1=CC(C)=C(N)C=C1

Synonyms:

• 4-[(4-Amino-3-methylphenyl)butylamino]-1-butanesulfonic acid
• 1-Butanesulfonic acid, 4-(4-amino-N-butyl-m-toluidino)-
• 1-Butanesulfonic acid, 4-[(4-amino-3-methylphenyl)butylamino]-

1-Butanesulfonic acid, 4-[(4-amino-3-methylphenyl)butylamino]-

CAS: 16318-87-9

Formula: C₁₅H₂₆N₂O₃S

Molecular weight: 314.4435

Ref: IN-DA001TUE