CAS 1632-73-1: Fenchol
Description:Fenchol is a bicyclic monoterpene alcohol, primarily derived from natural sources such as essential oils of various plants, including fennel and rosemary. It is characterized by its pleasant, fresh, and slightly woody aroma, making it a popular ingredient in the fragrance and flavor industries. Fenchol has a molecular formula of C10H18O and features a bicyclo[3.3.1]nonane structure, which contributes to its unique properties. It is typically a colorless to pale yellow liquid with a relatively low boiling point. Fenchol exhibits moderate solubility in water and is more soluble in organic solvents, reflecting its hydrophobic nature. Additionally, it possesses antimicrobial and antioxidant properties, which have garnered interest in food preservation and cosmetic applications. Its safety profile is generally favorable, although, like many compounds, it should be used in moderation to avoid potential skin irritation or allergic reactions. Overall, fenchol is valued for both its sensory attributes and functional benefits in various formulations.
Formula:C10H18O
InChI:InChI=1S/C10H18O/c1-9(2)7-4-5-10(3,6-7)8(9)11/h7-8,11H,4-6H2,1-3H3
InChI key:InChIKey=IAIHUHQCLTYTSF-UHFFFAOYSA-N
SMILES:OC1C(C)(C)C2CCC1(C)C2
- Synonyms:
- (1S,2S,4R)-1,3,3-trimethylbicyclo[2.2.1]heptan-2-ol
- (1S,4R)-1,3,3-trimethylbicyclo[2.2.1]heptan-2-ol
- 1,3,3-Trimethyl-2-norbornanol
- 1,3,3-Trimethylbicyclo(2.2.1)Heptan-2-Ol
- 2,2,4-Trimethylbicyclo[2.2.1]heptan-3-ol
- 2-Fenchanol
- 2-Norbornanol, 1,3,3-trimethyl-
- Bicyclo[2.2.1]heptan-2-ol, 1,3,3-trimethyl-
- Fenchol
- Fenchyl alcohol
- See more synonyms