CAS 163217-77-4

(2Z)-2-benzylidene-N-(2-benzyloxyphenyl)-4-methyl-3-oxo-pentanamide

Description:

(2Z)-2-benzylidene-N-(2-benzyloxyphenyl)-4-methyl-3-oxo-pentanamide is a synthetic organic compound characterized by its complex structure, which includes a benzylidene group, an amide functional group, and multiple aromatic rings. This compound features a ketone functional group, contributing to its reactivity and potential applications in organic synthesis. The presence of the benzyloxyphenyl moiety enhances its lipophilicity, which may influence its solubility in organic solvents. The compound's stereochemistry, indicated by the (2Z) configuration, suggests a specific geometric arrangement around the double bond, which can affect its biological activity and interaction with other molecules. Due to its structural features, it may exhibit interesting pharmacological properties, making it a candidate for further research in medicinal chemistry. Additionally, the compound's molecular weight and specific functional groups can influence its stability, reactivity, and potential applications in various fields, including pharmaceuticals and materials science. Overall, this compound represents a fascinating area of study for chemists interested in organic synthesis and drug development.

Formula: C₂₆H₂₅NO₃

InChI: InChI=1/C26H25NO3/c1-19(2)25(28)22(17-20-11-5-3-6-12-20)26(29)27-23-15-9-10-16-24(23)30-18-21-13-7-4-8-14-21/h3-17,19H,18H2,1-2H3,(H,27,29)/b22-17-

SMILES: CC(C)C(=O)/C(=C/c1ccccc1)/C(=Nc1ccccc1OCc1ccccc1)O

Pentanamide, 4-methyl-3-oxo-N-[2-(phenylmethoxy)phenyl]-2-(phenylmethylene)-

CAS: 163217-77-4

Formula: C₂₆H₂₅NO₃

Molecular weight: 399.4816

Ref: IN-DA001TV9