CymitQuimica logo

CAS 1632286-02-2

:

8-Methoxy-3-phenyl-1,7-naphthyridin-2-yl 1,1,1-trifluoromethanesulfonate

Description:
8-Methoxy-3-phenyl-1,7-naphthyridin-2-yl 1,1,1-trifluoromethanesulfonate is a chemical compound characterized by its complex structure, which includes a naphthyridine core substituted with a methoxy group and a phenyl group. The presence of the trifluoromethanesulfonate moiety indicates that it is a sulfonate ester, which typically enhances its reactivity, particularly in nucleophilic substitution reactions. This compound may exhibit properties such as high lipophilicity due to the aromatic and aliphatic components, making it potentially useful in medicinal chemistry or as a synthetic intermediate. Its trifluoromethanesulfonate group can serve as a leaving group in various chemical transformations. Additionally, the presence of fluorine atoms often imparts unique electronic properties, which can influence the compound's reactivity and interaction with biological targets. Overall, this compound's characteristics suggest it may have applications in drug development or as a reagent in organic synthesis, although specific biological activity and stability would require further investigation.
Formula:C16H11F3N2O4S
InChI:InChI=1S/C16H11F3N2O4S/c1-24-15-13-11(7-8-20-15)9-12(10-5-3-2-4-6-10)14(21-13)25-26(22,23)16(17,18)19/h2-9H,1H3
InChI key:InChIKey=KLKOPIBJAKYFNF-UHFFFAOYSA-N
SMILES:O(S(C(F)(F)F)(=O)=O)C=1C(=CC2=C(N1)C(OC)=NC=C2)C3=CC=CC=C3
Synonyms:
  • 8-Methoxy-3-phenyl-1,7-naphthyridin-2-yl 1,1,1-trifluoromethanesulfonate
  • Methanesulfonic acid, 1,1,1-trifluoro-, 8-methoxy-3-phenyl-1,7-naphthyridin-2-yl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.