CAS 1632286-21-5
:4-[(4-Carboxyphenyl)methoxy]benzeneacetic acid
Description:
4-[(4-Carboxyphenyl)methoxy]benzeneacetic acid, identified by its CAS number 1632286-21-5, is an organic compound characterized by its aromatic structure and functional groups. It features a benzene ring substituted with a methoxy group and a carboxylic acid group, which contributes to its acidic properties. The presence of the carboxylic acid group indicates that it can participate in acid-base reactions, making it a potential candidate for various chemical applications, including pharmaceuticals and agrochemicals. The methoxy group enhances its solubility in organic solvents and may influence its biological activity. This compound may exhibit properties such as anti-inflammatory or analgesic effects, typical of many aromatic carboxylic acids. Its molecular structure suggests potential for hydrogen bonding, which can affect its physical properties, such as melting point and solubility in water. Overall, 4-[(4-Carboxyphenyl)methoxy]benzeneacetic acid is a versatile compound with potential applications in medicinal chemistry and materials science.
Formula:C16H14O5
InChI:InChI=1S/C16H14O5/c17-15(18)9-11-3-7-14(8-4-11)21-10-12-1-5-13(6-2-12)16(19)20/h1-8H,9-10H2,(H,17,18)(H,19,20)
InChI key:InChIKey=GTZLXCKTJZVFBT-UHFFFAOYSA-N
SMILES:C(C(O)=O)C1=CC=C(OCC2=CC=C(C(O)=O)C=C2)C=C1
Synonyms:- Benzeneacetic acid, 4-[(4-carboxyphenyl)methoxy]-
- 4-[(4-Carboxyphenyl)methoxy]benzeneacetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
