CymitQuimica logo

CAS 163266-04-4

:

2-Fluoro-1,1-cyclopropanedicarboxylic acid

Description:
2-Fluoro-1,1-cyclopropanedicarboxylic acid is a fluorinated organic compound characterized by its cyclopropane ring structure, which is substituted with two carboxylic acid groups and a fluorine atom. The presence of the fluorine atom introduces unique reactivity and polarity, influencing the compound's chemical behavior and potential applications. The cyclopropane moiety contributes to the strain and rigidity of the molecule, which can affect its stability and reactivity in various chemical reactions. As a dicarboxylic acid, it exhibits acidic properties, allowing it to participate in acid-base reactions and potentially form salts or esters. The compound may also engage in nucleophilic substitution reactions due to the presence of the fluorine atom. Its unique structure makes it of interest in medicinal chemistry and materials science, where fluorinated compounds often exhibit enhanced biological activity or altered physical properties. However, specific applications and reactivity would depend on further studies and context within synthetic pathways or biological systems.
Formula:C5H5FO4
InChI:InChI=1S/C5H5FO4/c6-2-1-5(2,3(7)8)4(9)10/h2H,1H2,(H,7,8)(H,9,10)
InChI key:InChIKey=FKEMAYUZSSPUGG-UHFFFAOYSA-N
SMILES:C(O)(=O)C1(C(O)=O)C(F)C1
Synonyms:
  • 1,1-Cyclopropanedicarboxylic acid, 2-fluoro-
  • 2-Fluoro-1,1-cyclopropanedicarboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.