CAS 16332-22-2
:Ethyl 4-hydroxy-4-phenyl-1-piperidinecarboxylate
Description:
Ethyl 4-hydroxy-4-phenyl-1-piperidinecarboxylate, with the CAS number 16332-22-2, is a chemical compound that belongs to the class of piperidine derivatives. It features a piperidine ring substituted with a phenyl group and a carboxylate moiety, which contributes to its unique properties. The presence of the hydroxy group enhances its solubility in polar solvents and may influence its reactivity and biological activity. This compound is often studied for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its structural similarity to various bioactive molecules. Its molecular structure allows for interactions with biological targets, making it of interest in drug design and synthesis. Additionally, the ethyl ester functionality can be hydrolyzed to yield the corresponding acid, which may further expand its utility in chemical reactions. Overall, Ethyl 4-hydroxy-4-phenyl-1-piperidinecarboxylate is a versatile compound with potential implications in various fields of research and development.
Formula:C14H19NO3
InChI:InChI=1S/C14H19NO3/c1-2-18-13(16)15-10-8-14(17,9-11-15)12-6-4-3-5-7-12/h3-7,17H,2,8-11H2,1H3
InChI key:InChIKey=YDYRNUOFYGNGMF-UHFFFAOYSA-N
SMILES:OC1(CCN(C(OCC)=O)CC1)C2=CC=CC=C2
Synonyms:- 1-Piperidinecarboxylic acid, 4-hydroxy-4-phenyl-, ethyl ester
- Ethyl 4-hydroxy-4-phenyl-1-piperidinecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
