CAS 16350-85-9

1-Butyl-2,5-piperazinedione

Description:

1-Butyl-2,5-piperazinedione, with the CAS number 16350-85-9, is a chemical compound characterized by its piperazine ring structure, which is a six-membered ring containing two nitrogen atoms. This compound features a butyl group attached to the piperazine, contributing to its hydrophobic characteristics. It typically appears as a solid or a viscous liquid, depending on the temperature and purity. The presence of the diketone functional groups (two carbonyl groups) in the piperazine ring imparts unique reactivity, making it a potential candidate for various chemical reactions, including condensation and cyclization. Its solubility is generally moderate in polar solvents, and it may exhibit biological activity, which could be of interest in pharmaceutical applications. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 1-butyl-2,5-piperazinedione is a versatile compound with potential applications in organic synthesis and medicinal chemistry.

Formula: C₈H₁₄N₂O₂

InChI: InChI=1S/C8H14N2O2/c1-2-3-4-10-6-7(11)9-5-8(10)12/h2-6H2,1H3,(H,9,11)

InChI key: InChIKey=GHXVGVFQOFBEOP-UHFFFAOYSA-N

SMILES: C(CCC)N1C(=O)CNC(=O)C1

Synonyms:

• 1-Butyl-2,5-piperazinedione
• 2,5-Piperazinedione, 1-butyl-

2,5-Piperazinedione, 1-butyl-

CAS: 16350-85-9

Formula: C₈H₁₄N₂O₂

Molecular weight: 170.209

Ref: IN-DA001U6J