CymitQuimica logo

CAS 163517-62-2

:

5-Fluoro-2-methylphenylboronic acid

Description:
5-Fluoro-2-methylphenylboronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that is substituted with both a fluorine atom and a methyl group. This compound typically appears as a white to off-white solid and is soluble in polar organic solvents. Its molecular structure allows it to participate in various chemical reactions, particularly in Suzuki-Miyaura cross-coupling reactions, which are essential in the synthesis of biaryl compounds. The presence of the fluorine atom can influence the electronic properties of the molecule, potentially enhancing its reactivity and selectivity in chemical transformations. Additionally, boronic acids are known for their ability to form reversible complexes with diols, making them useful in various applications, including drug development and materials science. The compound's unique characteristics make it a valuable intermediate in organic synthesis and medicinal chemistry. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C7H8BFO2
InChI:InChI=1S/C7H8BFO2/c1-5-2-3-6(9)4-7(5)8(10)11/h2-4,10-11H,1H3
InChI key:InChIKey=QKOJLMKWBRBZNQ-UHFFFAOYSA-N
SMILES:B(O)(O)C1=C(C)C=CC(F)=C1
Synonyms:
  • 2-Methyl-5-fluorophenylboronic acid
  • 5-Fluoro-2-methylbenzeneboronic acid
  • 5-Fluoro-2-methylphenylboronic acid~5-Fluoro-o-tolylboronic acid
  • B-(5-Fluoro-2-methylphenyl)boronic acid
  • Boronic acid, (5-fluoro-2-methylphenyl)-
  • Boronic acid, B-(5-fluoro-2-methylphenyl)-
  • 5-Fluoro-2-methylphenylboronic acid
Found 8 products.