
CAS 163563-02-8
:[3,3′-Bipyridin]-2-amine
Description:
[3,3′-Bipyridin]-2-amine, with the CAS number 163563-02-8, is an organic compound characterized by its bipyridine structure, which consists of two pyridine rings connected by a carbon-carbon bond. The presence of an amino group (-NH2) at the 2-position of one of the pyridine rings enhances its reactivity and solubility in polar solvents. This compound typically exhibits properties such as being a solid at room temperature, with potential applications in coordination chemistry, organic synthesis, and as a ligand in metal complexes. Its structural features allow it to participate in hydrogen bonding and coordination with metal ions, making it useful in catalysis and material science. Additionally, [3,3′-Bipyridin]-2-amine may exhibit biological activity, which could be explored for pharmaceutical applications. As with many nitrogen-containing heterocycles, it may also display interesting electronic properties, contributing to its utility in various chemical contexts. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C10H9N3
InChI:InChI=1S/C10H9N3/c11-10-9(4-2-6-13-10)8-3-1-5-12-7-8/h1-7H,(H2,11,13)
InChI key:InChIKey=ZKDRHGPINCUARO-UHFFFAOYSA-N
SMILES:NC1=C(C=2C=CC=NC2)C=CC=N1
Synonyms:- [3,3′-Bipyridin]-2-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
