CAS 1636-41-5
:4,5-Diethyloctane
Description:
4,5-Diethyloctane is an organic compound classified as an alkane, specifically a branched-chain hydrocarbon. It consists of a linear octane backbone with two ethyl groups attached to the fourth and fifth carbon atoms. This structure contributes to its physical properties, such as a relatively high boiling point and low volatility compared to smaller alkanes. 4,5-Diethyloctane is typically a colorless liquid at room temperature and is insoluble in water, but soluble in organic solvents. Its molecular formula reflects its composition of carbon and hydrogen atoms, which is characteristic of hydrocarbons. The compound is primarily of interest in the fields of organic chemistry and petrochemical research, where it may be studied for its potential applications as a fuel additive or in the synthesis of more complex organic molecules. Safety data indicates that, like many hydrocarbons, it should be handled with care due to flammability and potential health hazards upon exposure.
Formula:C12H26
InChI:InChI=1S/C12H26/c1-5-9-11(7-3)12(8-4)10-6-2/h11-12H,5-10H2,1-4H3
InChI key:InChIKey=XRVCHXCONYJHLU-UHFFFAOYSA-N
SMILES:C(C(CCC)CC)(CCC)CC
Synonyms:- Octane, 4,5-diethyl-
- 4,5-Diethyloctane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
