CAS 163734-06-3
:3-(2-amino-6-oxo-1H-purin-7-yl)-2-hydroxy-propanamide
Description:
3-(2-amino-6-oxo-1H-purin-7-yl)-2-hydroxy-propanamide, also known by its CAS number 163734-06-3, is a chemical compound that features a purine base structure, which is characteristic of nucleobases found in DNA and RNA. This compound contains an amino group and a hydroxyl group, contributing to its potential biological activity. The presence of the 6-oxo group indicates that it is a derivative of a purine, which may influence its interactions with biological macromolecules. The propanamide moiety suggests that it may participate in hydrogen bonding, enhancing its solubility and reactivity in biological systems. This compound may be of interest in medicinal chemistry and biochemistry due to its structural similarity to nucleotides, potentially allowing it to act as a substrate or inhibitor in enzymatic reactions. Its specific properties, such as solubility, stability, and reactivity, would depend on the surrounding conditions, including pH and temperature, making it a subject of interest for further research in pharmacology and molecular biology.
Formula:C8H10N6O3
InChI:InChI=1/C8H10N6O3/c9-5(16)3(15)1-14-2-11-6-4(14)7(17)13-8(10)12-6/h2-3,15H,1H2,(H2,9,16)(H3,10,12,13,17)
SMILES:C(C(C(=N)O)O)n1cnc2c1c(nc(=N)[nH]2)O
Synonyms:- N7-(2-Carbamoyl-2-hydroxyethyl)guanine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
7H-Purine-7-propanamide, 2-amino-1,6-dihydro-α-hydroxy-6-oxo-
CAS:Formula:C8H10N6O3Color and Shape:SolidMolecular weight:238.2034N7-(2-Carbamoyl-2-hydroxyethyl)guanine
CAS:Controlled ProductApplications A DNA adduct of glycidamide.
References Bergmark, E., et al.: Toxicol. Appl. Pharmacol., 111, 352 (1991), Swenberg, J.A., et al.: Toxicol. Lett., 82, 751 (1995),Formula:C8H10N6O3Color and Shape:NeatMolecular weight:238.2

