CymitQuimica logo

CAS 16382-17-5

:

ethyl 5-ethoxy-1H-indole-2-carboxylate

Description:
Ethyl 5-ethoxy-1H-indole-2-carboxylate, with the CAS number 16382-17-5, is a chemical compound that belongs to the indole family, which is characterized by a bicyclic structure containing a fused benzene and pyrrole ring. This compound features an ethyl ester functional group, which contributes to its solubility and reactivity. The presence of the ethoxy group enhances its lipophilicity, making it more soluble in organic solvents. Ethyl 5-ethoxy-1H-indole-2-carboxylate is often studied for its potential biological activities, including its role in medicinal chemistry and as a precursor in the synthesis of various pharmaceuticals. The indole structure is known for its diverse range of biological activities, including anti-inflammatory and antimicrobial properties. Additionally, the compound may exhibit interesting optical properties due to its conjugated system. As with many organic compounds, its stability and reactivity can be influenced by environmental factors such as temperature and pH. Proper handling and storage are essential to maintain its integrity and prevent degradation.
Formula:C13H15NO3
InChI:InChI=1S/C13H15NO3/c1-3-16-10-5-6-11-9(7-10)8-12(14-11)13(15)17-4-2/h5-8,14H,3-4H2,1-2H3
InChI key:IMFWDOPIAXKRBO-UHFFFAOYSA-N
SMILES:CCOC1=CC2=C(C=C1)NC(=C2)C(=O)OCC
Found 4 products.