CymitQuimica logo

CAS 1638221-35-8

:

1,4,9-Triazaspiro[5.5]undecan-5-one, hydrochloride (1:2)

Description:
1,4,9-Triazaspiro[5.5]undecan-5-one, hydrochloride (1:2) is a chemical compound characterized by its unique spirocyclic structure, which incorporates three nitrogen atoms within a bicyclic framework. This compound features a ketone functional group, contributing to its reactivity and potential applications in various chemical processes. The hydrochloride form indicates that it is a salt, which enhances its solubility in polar solvents, making it suitable for use in biological and pharmaceutical contexts. The presence of multiple nitrogen atoms suggests potential for coordination chemistry and interactions with biological macromolecules. Additionally, the compound may exhibit interesting pharmacological properties, although specific biological activities would require further investigation. Its molecular structure and properties make it a candidate for research in medicinal chemistry, particularly in the development of novel therapeutic agents. As with many nitrogen-containing heterocycles, it may also display unique electronic properties, influencing its behavior in chemical reactions and interactions.
Formula:C8H15N3O·2ClH
InChI:InChI=1S/C8H15N3O.2ClH/c12-7-8(11-6-5-10-7)1-3-9-4-2-8;;/h9,11H,1-6H2,(H,10,12);2*1H
InChI key:InChIKey=OXFSLLMEPPTYDY-UHFFFAOYSA-N
SMILES:O=C1C2(CCNCC2)NCCN1.Cl
Synonyms:
  • 1,4,9-Triazaspiro[5.5]undecan-5-one, hydrochloride (1:2)
Found 2 products.