CymitQuimica logo

CAS 16383-96-3

:

13H-Thioxantheno[2,1,9-def][1,2,4]triazolo[1,5-b]isoquinolin-13-one

Description:
13H-Thioxantheno[2,1,9-def][1,2,4]triazolo[1,5-b]isoquinolin-13-one, with the CAS number 16383-96-3, is a complex heterocyclic compound characterized by its unique fused ring system that incorporates thioxanthene, triazole, and isoquinoline moieties. This compound typically exhibits a range of interesting chemical properties, including potential biological activity, which may be attributed to its structural features. The presence of nitrogen and sulfur atoms in its structure can influence its reactivity and solubility, making it a candidate for various applications in medicinal chemistry and materials science. Additionally, compounds of this nature may display fluorescence or other photophysical properties, which can be useful in imaging or sensing applications. Its synthesis often involves multi-step organic reactions, and its characterization can be achieved through techniques such as NMR spectroscopy, mass spectrometry, and X-ray crystallography. Overall, this compound represents a fascinating area of study within the field of organic chemistry, particularly in the context of developing new therapeutic agents.
Formula:C19H9N3OS
InChI:InChI=1S/C19H9N3OS/c23-19-13-6-5-11-10-3-1-2-4-14(10)24-15-8-7-12(16(13)17(11)15)18-20-9-21-22(18)19/h1-9H
InChI key:InChIKey=JCVXCFHVNJJCCM-UHFFFAOYSA-N
SMILES:O=C1C=2C3=C4C(C=5C(SC4=CC=C3C=6N1N=CN6)=CC=CC5)=CC2
Synonyms:
  • 13H-Thioxantheno[2,1,9-def][1,2,4]triazolo[1,5-b]isoquinolin-13-one
  • 13H-Thioxantheno[2,1,9-def]-s-triazolo[1,5-b]isoquinolin-13-one
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.