CymitQuimica logo

CAS 1638767-00-6

:

Methyl 2-amino-7H-pyrrolo[2,3-d]pyrimidine-5-carboxylate

Description:
Methyl 2-amino-7H-pyrrolo[2,3-d]pyrimidine-5-carboxylate is a heterocyclic organic compound characterized by its complex bicyclic structure, which incorporates both pyrrole and pyrimidine rings. This compound features an amino group and a carboxylate ester, contributing to its potential reactivity and biological activity. It is typically a solid at room temperature and may exhibit solubility in polar organic solvents due to the presence of functional groups. The compound's molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as it may interact with biological targets due to its nitrogen-containing rings. Additionally, its unique arrangement of atoms may confer specific properties such as stability, reactivity, and the ability to form hydrogen bonds. As with many heterocycles, it may also exhibit interesting electronic properties, making it a subject of interest in materials science and organic synthesis. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C8H8N4O2
InChI:InChI=1S/C8H8N4O2/c1-14-7(13)5-3-10-6-4(5)2-11-8(9)12-6/h2-3H,1H3,(H3,9,10,11,12)
InChI key:InChIKey=DENGDMKTYAXXRH-UHFFFAOYSA-N
SMILES:C(OC)(=O)C=1C=2C(NC1)=NC(N)=NC2
Synonyms:
  • Methyl 2-amino-7H-pyrrolo[2,3-d]pyrimidine-5-carboxylate
  • 7H-Pyrrolo[2,3-d]pyrimidine-5-carboxylic acid, 2-amino-, methyl ester
Found 1 products.