CymitQuimica logo

CAS 1638767-60-8

:

Methyl 2,4-dichloro-7-(phenylsulfonyl)-7H-pyrrolo[2,3-d]pyrimidine-6-carboxylate

Description:
Methyl 2,4-dichloro-7-(phenylsulfonyl)-7H-pyrrolo[2,3-d]pyrimidine-6-carboxylate is a synthetic organic compound characterized by its complex heterocyclic structure, which includes a pyrrolo[2,3-d]pyrimidine core. This compound features multiple functional groups, including a methyl ester, dichloro substituents, and a phenylsulfonyl moiety, contributing to its potential reactivity and biological activity. The presence of chlorine atoms enhances its lipophilicity and may influence its interaction with biological targets. The sulfonyl group can serve as a site for further chemical modifications or interactions with proteins. This compound is likely to exhibit specific pharmacological properties, making it of interest in medicinal chemistry and drug development. Its unique structure may confer selectivity towards certain biological pathways, potentially leading to therapeutic applications. As with many synthetic compounds, its stability, solubility, and reactivity can vary based on environmental conditions and the presence of other chemical species. Safety and handling precautions should be observed due to the presence of halogenated and sulfonyl groups, which may pose health risks.
Formula:C14H9Cl2N3O4S
InChI:InChI=1S/C14H9Cl2N3O4S/c1-23-13(20)10-7-9-11(15)17-14(16)18-12(9)19(10)24(21,22)8-5-3-2-4-6-8/h2-7H,1H3
InChI key:InChIKey=PKHCQAGHQIACFK-UHFFFAOYSA-N
SMILES:S(=O)(=O)(N1C=2C(C=C1C(OC)=O)=C(Cl)N=C(Cl)N2)C3=CC=CC=C3
Synonyms:
  • Methyl 2,4-dichloro-7-(phenylsulfonyl)-7H-pyrrolo[2,3-d]pyrimidine-6-carboxylate
  • 7H-Pyrrolo[2,3-d]pyrimidine-6-carboxylic acid, 2,4-dichloro-7-(phenylsulfonyl)-, methyl ester
Found 2 products.