CymitQuimica logo

CAS 163878-63-5

:

Uridine,5'-O-[bis(4-methoxyphenyl)phenylmethyl]-2'-O-(2-methoxyethyl)-5-methyl-, 3'-[2-cyanoethyl bis(1-methylethyl)phosphoramidite]

Description:
Uridine, 5'-O-[bis(4-methoxyphenyl)phenylmethyl]-2'-O-(2-methoxyethyl)-5-methyl-, 3'-[2-cyanoethyl bis(1-methylethyl)phosphoramidite] is a complex nucleoside derivative characterized by its unique structural features that include a uridine base, multiple methoxyphenyl groups, and a phosphoramidite moiety. This compound is typically used in the field of nucleic acid chemistry, particularly in the synthesis of oligonucleotides, due to its ability to facilitate the incorporation of modified nucleotides into RNA or DNA strands. The presence of methoxy groups enhances solubility and stability, while the phosphoramidite functionality allows for efficient coupling reactions during oligonucleotide synthesis. Additionally, the cyanoethyl group contributes to the overall reactivity of the phosphoramidite, making it a valuable intermediate in the synthesis of various nucleic acid constructs. Overall, this compound exemplifies the intricate design often employed in the development of nucleoside analogs for research and therapeutic applications.
Formula:C43H55N4O10P
InChI:InChI=1S/C43H55N4O10P/c1-29(2)47(30(3)4)58(55-24-12-23-44)57-38-37(56-41(39(38)53-26-25-50-6)46-27-31(5)40(48)45-42(46)49)28-54-43(32-13-10-9-11-14-32,33-15-19-35(51-7)20-16-33)34-17-21-36(52-8)22-18-34/h9-11,13-22,27,29-30,37-39,41H,12,24-26,28H2,1-8H3,(H,45,48,49)/t37-,38-,39-,41-,58?/m1/s1
InChI key:YFRRKZDUDXHJNC-KZQAAKLLSA-N
SMILES:CC1=CN(C(=O)NC1=O)[C@H]2[C@@H]([C@@H]([C@H](O2)COC(C3=CC=CC=C3)(C4=CC=C(C=C4)OC)C5=CC=C(C=C5)OC)OP(N(C(C)C)C(C)C)OCCC#N)OCCOC
Synonyms:
  • 5-Methyl-5'-DMT-2'-O-Methyl-Uridine
  • DMT-2'-O-MOE-T-CE Phosphoramidite
  • 5-Me-DMT-2'-O-MOE-U-CE-Phosphoramidite
Found 10 products.