CAS 16398-07-5
:2-chloro-N-(2-hydroxyphenyl)-5-nitrobenzamide
Description:
2-Chloro-N-(2-hydroxyphenyl)-5-nitrobenzamide, with the CAS number 16398-07-5, is an organic compound characterized by its complex structure, which includes a chloro group, a nitro group, and an amide functional group. This compound typically appears as a crystalline solid and is soluble in organic solvents, reflecting its aromatic nature. The presence of the chloro and nitro substituents on the benzene rings contributes to its chemical reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. The hydroxyl group enhances its polarity, which can influence its solubility and interaction with biological systems. This compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of therapeutic agents. Its specific properties, such as melting point, boiling point, and spectral characteristics, would need to be determined through experimental methods or referenced from chemical databases for precise applications in research and industry.
Formula:C13H9ClN2O4
InChI:InChI=1/C13H9ClN2O4/c14-10-6-5-8(16(19)20)7-9(10)13(18)15-11-3-1-2-4-12(11)17/h1-7,17H,(H,15,18)
SMILES:c1ccc(c(c1)N=C(c1cc(ccc1Cl)N(=O)=O)O)O
Synonyms:- benzamide, 2-chloro-N-(2-hydroxyphenyl)-5-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
