CymitQuimica logo

CAS 16404-16-3

:

2,6,8-trichloro-7-methylpurine

Description:
2,6,8-Trichloro-7-methylpurine is a synthetic purine derivative characterized by the presence of three chlorine atoms and a methyl group attached to its purine structure. This compound is typically recognized for its role in biochemical research, particularly in studies related to nucleic acids and their analogs. The chlorination at positions 2, 6, and 8 of the purine ring significantly alters its chemical reactivity and biological activity compared to unmodified purines. It is often utilized in the synthesis of nucleoside analogs and can exhibit properties such as antimicrobial or antiviral activity, depending on its specific interactions within biological systems. The presence of the methyl group at position 7 can influence the compound's solubility and stability. As with many halogenated compounds, 2,6,8-trichloro-7-methylpurine may also pose environmental and health risks, necessitating careful handling and disposal in laboratory settings. Overall, its unique structure makes it a valuable compound in medicinal chemistry and molecular biology research.
Formula:C6H3Cl3N4
InChI:InChI=1/C6H3Cl3N4/c1-13-2-3(7)10-5(8)11-4(2)12-6(13)9/h1H3
InChI key:UMASKSWPRALKCL-UHFFFAOYSA-N
SMILES:Cn1c2c(Cl)nc(Cl)nc2nc1Cl
Synonyms:
  • 2,6,8-trichloro-7-methyl-7H-purine
Found 3 products.