CAS 16404-94-7
:(S)-(-)-4-oxo-2-azetidinecarboxylic acid
Description:
(S)-(-)-4-oxo-2-azetidinecarboxylic acid, also known as L-threonine, is a chiral compound characterized by its unique four-membered azetidine ring structure, which contributes to its biological activity. This compound features a carboxylic acid functional group and a ketone group, making it an important intermediate in various synthetic pathways. It is typically a white to off-white crystalline solid that is soluble in water, reflecting its polar nature due to the presence of the carboxylic acid. The stereochemistry of the molecule is significant, as the (S)-configuration is associated with specific biological functions, particularly in the context of amino acid metabolism. This compound is often studied for its role in the synthesis of pharmaceuticals and as a building block in peptide synthesis. Additionally, its derivatives may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Overall, (S)-(-)-4-oxo-2-azetidinecarboxylic acid is a versatile compound with implications in both organic synthesis and biochemistry.
Formula:C4H5NO3
InChI:InChI=1/C4H5NO3/c6-3-1-2(5-3)4(7)8/h2H,1H2,(H,5,6)(H,7,8)/t2-/m0/s1
SMILES:C1[C@@H](C(=O)O)N=C1O
Synonyms:- (2S)-4-oxoazetidine-2-carboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(S)-4-Oxoazetidine-2-carboxylic acid
CAS:(S)-4-Oxoazetidine-2-carboxylic acidFormula:C4H5NO3Purity:95%Molecular weight:115.092-Azetidinecarboxylic acid, 4-oxo-, (2S)-
CAS:Formula:C4H5NO3Purity:97%Color and Shape:SolidMolecular weight:115.0874(S)-4-Oxoazetidine-2-carboxylic Acid
CAS:Controlled ProductApplications (S)-4-Oxoazetidine-2-carboxylic Acid, is a building block used for various chemical synthesis such as for the synthesis of NMDA receptor antagonists, 3-alkyl-L-aspartic acids, and orally active β-lactam inhibitors.
References Baldwin, J.E. et al. Tetrahedron 51, 11581-11581, (1995); Hanessian, S. et al. Synlett , 33-33, (1992)Formula:C4H5NO3Color and Shape:NeatMolecular weight:115.09



