CAS 164071-58-3
:(αS)-α-(2-Iodoethyl)-2-thiophenemethanol
Description:
(αS)-α-(2-Iodoethyl)-2-thiophenemethanol is a chemical compound characterized by its unique structure, which includes a thiophene ring and an iodoethyl group. This compound typically exhibits properties associated with both the thiophene moiety and the presence of the iodine atom, such as potential reactivity in nucleophilic substitution reactions due to the electrophilic nature of the iodine. The thiophene ring contributes to the compound's aromatic characteristics, which may influence its solubility and stability in various solvents. Additionally, the presence of the hydroxyl group (alcohol functionality) can impart hydrogen bonding capabilities, affecting its physical properties like boiling point and solubility in polar solvents. The stereochemistry indicated by the (αS) designation suggests specific spatial arrangements that may influence the compound's biological activity and interactions with other molecules. Overall, this compound may find applications in organic synthesis, medicinal chemistry, or as a building block for more complex chemical entities.
Formula:C7H9IOS
InChI:InChI=1S/C7H9IOS/c8-4-3-6(9)7-2-1-5-10-7/h1-2,5-6,9H,3-4H2/t6-/m0/s1
InChI key:InChIKey=KRZSQNQECJUPRL-LURJTMIESA-N
SMILES:[C@@H](CCI)(O)C1=CC=CS1
Synonyms:- 2-Thiophenemethanol α-(2-iodoethyl)-, (αS)-
- (αS)-α-(2-Iodoethyl)-2-thiophenemethanol
- 2-Thiophenemethanol, α-(2-iodoethyl)-, (S)-
- 2-Thiophenemethanol, α-(2-iodoethyl)-, (αS)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
