CAS 1640995-61-4
:2-Ethoxy-5-(ethoxymethyl)thiazole
Description:
2-Ethoxy-5-(ethoxymethyl)thiazole is a chemical compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen atoms. This compound features ethoxy groups, which contribute to its solubility and reactivity. The presence of the ethoxymethyl substituent enhances its potential for various chemical reactions, making it a candidate for applications in pharmaceuticals or agrochemicals. Typically, thiazole derivatives exhibit biological activity, including antimicrobial and antifungal properties, due to their ability to interact with biological targets. The molecular structure suggests that it may possess moderate polarity, influencing its interactions in biological systems. Additionally, the compound's stability and reactivity can be affected by environmental factors such as pH and temperature. As with many thiazole derivatives, understanding its properties requires consideration of its synthesis, potential toxicity, and environmental impact, which are crucial for its safe handling and application in various fields.
Formula:C8H13NO2S
InChI:InChI=1S/C8H13NO2S/c1-3-10-6-7-5-9-8(12-7)11-4-2/h5H,3-4,6H2,1-2H3
InChI key:InChIKey=PQXUUVURYZKINU-UHFFFAOYSA-N
SMILES:C(OCC)C=1SC(OCC)=NC1
Synonyms:- Thiazole, 2-ethoxy-5-(ethoxymethyl)-
- 2-Ethoxy-5-(ethoxymethyl)thiazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
