CAS 16424-31-0
:5-Oxotetradecanoic acid
Description:
5-Oxotetradecanoic acid, also known as 5-oxo-14-carbon fatty acid, is a fatty acid characterized by a long hydrocarbon chain with a ketone functional group at the fifth carbon position. Its molecular structure consists of a total of 14 carbon atoms, making it a medium-chain fatty acid. The presence of the ketone group introduces unique reactivity and properties compared to saturated fatty acids. This compound is typically a white to pale yellow solid at room temperature and is soluble in organic solvents but has limited solubility in water due to its hydrophobic nature. 5-Oxotetradecanoic acid can participate in various chemical reactions, including esterification and oxidation, making it relevant in biochemical and industrial applications. It may also play a role in metabolic pathways, particularly in the context of fatty acid metabolism. As with many fatty acids, its derivatives can be utilized in the synthesis of surfactants, lubricants, and other chemical intermediates. Safety and handling precautions should be observed, as with all chemical substances.
Formula:C14H26O3
InChI:InChI=1S/C14H26O3/c1-2-3-4-5-6-7-8-10-13(15)11-9-12-14(16)17/h2-12H2,1H3,(H,16,17)
InChI key:InChIKey=KGKVVLCMDWQMOR-UHFFFAOYSA-N
SMILES:C(C(CCCCCCCCC)=O)CCC(O)=O
Synonyms:- 5-Oxotetradecanoic acid
- Tetradecanoic acid, 5-oxo-
- 5-Oxomyristic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
